C11H11F11OS — CID 10916370
3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)thiolan-3-ol (PubChem CID 10916370) has the molecular formula C11H11F11OS and a molecular weight of 400.25 g/mol. Its IUPAC name is 3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)thiolan-3-ol.
| Compound Name | 3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)thiolan-3-ol |
|---|---|
| PubChem CID | 10916370 |
| Molecular Formula | C11H11F11OS |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptyl)thiolan-3-ol |
| SMILES | OC1(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCSC1 |
| InChI | InChI=1S/C11H11F11OS/c12-7(13,2-1-6(23)3-4-24-5-6)8(14,15)9(16,17)10(18,19)11(20,21)22/h23H,1-5H2 |
| InChIKey | RMNHRUKGWBINSA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|