C21H18N4O3 — CID 109164359
6-(2-cyanoanilino)-N-(2,4-dimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 109164359) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 6-(2-cyanoanilino)-N-(2,4-dimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 6-(2-cyanoanilino)-N-(2,4-dimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109164359 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 6-(2-cyanoanilino)-N-(2,4-dimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Nc3ccccc3C#N)nc2)c(OC)c1 |
| InChI | InChI=1S/C21H18N4O3/c1-27-16-8-9-18(19(11-16)28-2)25-21(26)15-7-10-20(23-13-15)24-17-6-4-3-5-14(17)12-22/h3-11,13H,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | FCVXJXKBDOFWOP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |