C17H19N3O4 — CID 109166947
methyl 2-[[2-(2-methoxyethylamino)pyridine-4-carbonyl]amino]benzoate (PubChem CID 109166947) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is methyl 2-[[2-(2-methoxyethylamino)pyridine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(2-methoxyethylamino)pyridine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109166947 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | methyl 2-[[2-(2-methoxyethylamino)pyridine-4-carbonyl]amino]benzoate |
| SMILES | COCCNc1cc(C(=O)Nc2ccccc2C(=O)OC)ccn1 |
| InChI | InChI=1S/C17H19N3O4/c1-23-10-9-19-15-11-12(7-8-18-15)16(21)20-14-6-4-3-5-13(14)17(22)24-2/h3-8,11H,9-10H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | JRGPKKUQBDVWQD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|