C23H29NO6 — CID 10916701
diethyl (3R,4S,8aS)-8a-methyl-1-oxo-4-phenyl-3-propan-2-yl-4,6-dihydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate (PubChem CID 10916701) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is diethyl (3R,4S,8aS)-8a-methyl-1-oxo-4-phenyl-3-propan-2-yl-4,6-dihydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate.
| Compound Name | diethyl (3R,4S,8aS)-8a-methyl-1-oxo-4-phenyl-3-propan-2-yl-4,6-dihydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
|---|---|
| PubChem CID | 10916701 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | diethyl (3R,4S,8aS)-8a-methyl-1-oxo-4-phenyl-3-propan-2-yl-4,6-dihydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)[C@@]2(C)C(=O)O[C@H](C(C)C)[C@H](c3ccccc3)N2C1 |
| InChI | InChI=1S/C23H29NO6/c1-6-28-20(25)16-13-24-18(15-11-9-8-10-12-15)19(14(3)4)30-22(27)23(24,5)17(16)21(26)29-7-2/h8-12,14,18-19H,6-7,13H2,1-5H3/t18-,19+,23-/m0/s1 |
| InChIKey | DSXMBZLLOVCGRF-YYDVJCTNSA-N |
| XLogP | 2.81 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|