C19H21N5O2 — CID 109168139
N-(2-cyanophenyl)-2-(2-morpholin-4-ylethylamino)pyridine-4-carboxamide (PubChem CID 109168139) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(2-morpholin-4-ylethylamino)pyridine-4-carboxamide.
| Compound Name | N-(2-cyanophenyl)-2-(2-morpholin-4-ylethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109168139 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-(2-cyanophenyl)-2-(2-morpholin-4-ylethylamino)pyridine-4-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)c1ccnc(NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C19H21N5O2/c20-14-16-3-1-2-4-17(16)23-19(25)15-5-6-21-18(13-15)22-7-8-24-9-11-26-12-10-24/h1-6,13H,7-12H2,(H,21,22)(H,23,25) |
| InChIKey | BTOZMMMYBSKALK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |