C19H15Cl2N3O — CID 109169498
N-benzyl-2-(2,3-dichloroanilino)pyridine-4-carboxamide (PubChem CID 109169498) has the molecular formula C19H15Cl2N3O and a molecular weight of 372.26 g/mol. Its IUPAC name is N-benzyl-2-(2,3-dichloroanilino)pyridine-4-carboxamide.
| Compound Name | N-benzyl-2-(2,3-dichloroanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109169498 |
| Molecular Formula | C19H15Cl2N3O |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-benzyl-2-(2,3-dichloroanilino)pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccnc(Nc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C19H15Cl2N3O/c20-15-7-4-8-16(18(15)21)24-17-11-14(9-10-22-17)19(25)23-12-13-5-2-1-3-6-13/h1-11H,12H2,(H,22,24)(H,23,25) |
| InChIKey | NMNNYYDADRPDKM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |