C20H17ClFN3O — CID 109169934
2-(3-chloro-4-fluoroanilino)-N-[(4-methylphenyl)methyl]pyridine-4-carboxamide (PubChem CID 109169934) has the molecular formula C20H17ClFN3O and a molecular weight of 369.83 g/mol. Its IUPAC name is 2-(3-chloro-4-fluoroanilino)-N-[(4-methylphenyl)methyl]pyridine-4-carboxamide.
| Compound Name | 2-(3-chloro-4-fluoroanilino)-N-[(4-methylphenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109169934 |
| Molecular Formula | C20H17ClFN3O |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(3-chloro-4-fluoroanilino)-N-[(4-methylphenyl)methyl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2ccnc(Nc3ccc(F)c(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C20H17ClFN3O/c1-13-2-4-14(5-3-13)12-24-20(26)15-8-9-23-19(10-15)25-16-6-7-18(22)17(21)11-16/h2-11H,12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | FFIBDIPJVUCOFO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |