C25H38O4Si — CID 10917002
(E,4S,5R,7S)-10-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethyl-7-phenylmethoxydec-8-en-1-yn-3-one (PubChem CID 10917002) has the molecular formula C25H38O4Si and a molecular weight of 430.66 g/mol. Its IUPAC name is (E,4S,5R,7S)-10-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethyl-7-phenylmethoxydec-8-en-1-yn-3-one.
| Compound Name | (E,4S,5R,7S)-10-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethyl-7-phenylmethoxydec-8-en-1-yn-3-one |
|---|---|
| PubChem CID | 10917002 |
| Molecular Formula | C25H38O4Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (E,4S,5R,7S)-10-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,8-dimethyl-7-phenylmethoxydec-8-en-1-yn-3-one |
| SMILES | C#CC(=O)[C@@H](C)[C@H](O)C[C@H](OCc1ccccc1)/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H38O4Si/c1-9-22(26)20(3)23(27)17-24(28-18-21-13-11-10-12-14-21)19(2)15-16-29-30(7,8)25(4,5)6/h1,10-15,20,23-24,27H,16-18H2,2-8H3/b19-15+/t20-,23-,24+/m1/s1 |
| InChIKey | JUGHGENOTIWRFY-KEAGLABLSA-N |
| XLogP | 5.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|