About ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate
ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate (PubChem CID 10917012) has the molecular formula C19H42O3Si4
and a molecular weight of 430.89 g/mol. Its IUPAC name is ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate |
| PubChem CID | 10917012 |
| Molecular Formula | C19H42O3Si4 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC[C@H](C[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C19H42O3Si4/c1-11-22-18(20)14-16-12-13-17(19(16)21)15-26(23(2,3)4,24(5,6)7)25(8,9)10/h16-17H,11-15H2,1-10H3/t16-,17-/m1/s1 |
| InChIKey | JIYSPVWAGAVAMK-IAGOWNOFSA-N |
| XLogP | 5.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate?
The IUPAC name of ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate (CID 10917012) is ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate.
What is the SMILES notation for ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate?
The canonical SMILES for ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate is CCOC(=O)C[C@H]1CC[C@H](C[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)C1=O.
What is the InChIKey of ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate?
The InChIKey is JIYSPVWAGAVAMK-IAGOWNOFSA-N. The full InChI is InChI=1S/C19H42O3Si4/c1-11-22-18(20)14-16-12-13-17(19(16)21)15-26(23(2,3)4,24(5,6)7)25(8,9)10/h16-17H,11-15H2,1-10H3/t16-,17-/m1/s1.
What are the key properties of ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate?
ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate has a molecular weight of 430.89 g/mol, XLogP of 5.23, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate is sourced from PubChem (CID 10917012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).