C19H42O3Si4 — CID 10917012
ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate (PubChem CID 10917012) has the molecular formula C19H42O3Si4 and a molecular weight of 430.89 g/mol. Its IUPAC name is ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate.
| Compound Name | ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 10917012 |
| Molecular Formula | C19H42O3Si4 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | ethyl 2-[(1R,3S)-2-oxo-3-[tris(trimethylsilyl)silylmethyl]cyclopentyl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC[C@H](C[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C19H42O3Si4/c1-11-22-18(20)14-16-12-13-17(19(16)21)15-26(23(2,3)4,24(5,6)7)25(8,9)10/h16-17H,11-15H2,1-10H3/t16-,17-/m1/s1 |
| InChIKey | JIYSPVWAGAVAMK-IAGOWNOFSA-N |
| XLogP | 5.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|