C23H24FN3O — CID 109170485
N-benzyl-2-[(2-fluorophenyl)methylamino]-N-propan-2-ylpyridine-4-carboxamide (PubChem CID 109170485) has the molecular formula C23H24FN3O and a molecular weight of 377.46 g/mol. Its IUPAC name is N-benzyl-2-[(2-fluorophenyl)methylamino]-N-propan-2-ylpyridine-4-carboxamide.
| Compound Name | N-benzyl-2-[(2-fluorophenyl)methylamino]-N-propan-2-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 109170485 |
| Molecular Formula | C23H24FN3O |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-benzyl-2-[(2-fluorophenyl)methylamino]-N-propan-2-ylpyridine-4-carboxamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)c1ccnc(NCc2ccccc2F)c1 |
| InChI | InChI=1S/C23H24FN3O/c1-17(2)27(16-18-8-4-3-5-9-18)23(28)19-12-13-25-22(14-19)26-15-20-10-6-7-11-21(20)24/h3-14,17H,15-16H2,1-2H3,(H,25,26) |
| InChIKey | XUFTVCHLOMWPOG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |