C21H19F2N3O — CID 109170555
2-[2-(2-fluorophenyl)ethylamino]-N-[(4-fluorophenyl)methyl]pyridine-4-carboxamide (PubChem CID 109170555) has the molecular formula C21H19F2N3O and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)ethylamino]-N-[(4-fluorophenyl)methyl]pyridine-4-carboxamide.
| Compound Name | 2-[2-(2-fluorophenyl)ethylamino]-N-[(4-fluorophenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109170555 |
| Molecular Formula | C21H19F2N3O |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[2-(2-fluorophenyl)ethylamino]-N-[(4-fluorophenyl)methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccnc(NCCc2ccccc2F)c1 |
| InChI | InChI=1S/C21H19F2N3O/c22-18-7-5-15(6-8-18)14-26-21(27)17-10-12-25-20(13-17)24-11-9-16-3-1-2-4-19(16)23/h1-8,10,12-13H,9,11,14H2,(H,24,25)(H,26,27) |
| InChIKey | DSWDUGHZXDKYLF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |