C21H20ClN3O3 — CID 109170766
N-[(2-chlorophenyl)methyl]-2-(3,4-dimethoxyanilino)pyridine-4-carboxamide (PubChem CID 109170766) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(3,4-dimethoxyanilino)pyridine-4-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(3,4-dimethoxyanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109170766 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(3,4-dimethoxyanilino)pyridine-4-carboxamide |
| SMILES | COc1ccc(Nc2cc(C(=O)NCc3ccccc3Cl)ccn2)cc1OC |
| InChI | InChI=1S/C21H20ClN3O3/c1-27-18-8-7-16(12-19(18)28-2)25-20-11-14(9-10-23-20)21(26)24-13-15-5-3-4-6-17(15)22/h3-12H,13H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | FKFZDZJZSHIEQK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |