C24H34O5S — CID 10917077
(1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-[(4-methoxyphenyl)methylsulfanyl]-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one (PubChem CID 10917077) has the molecular formula C24H34O5S and a molecular weight of 434.60 g/mol. Its IUPAC name is (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-[(4-methoxyphenyl)methylsulfanyl]-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one.
| Compound Name | (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-[(4-methoxyphenyl)methylsulfanyl]-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
|---|---|
| PubChem CID | 10917077 |
| Molecular Formula | C24H34O5S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-3-[(4-methoxyphenyl)methylsulfanyl]-7-methyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
| SMILES | COc1ccc(CS[C@@H]2CC(=O)O[C@@H](C)CCC/C=C/[C@@H]3C[C@H](O)C[C@H]3[C@@H]2O)cc1 |
| InChI | InChI=1S/C24H34O5S/c1-16-6-4-3-5-7-18-12-19(25)13-21(18)24(27)22(14-23(26)29-16)30-15-17-8-10-20(28-2)11-9-17/h5,7-11,16,18-19,21-22,24-25,27H,3-4,6,12-15H2,1-2H3/b7-5+/t16-,18+,19-,21+,22+,24-/m0/s1 |
| InChIKey | ZRNAFRGYJDHEFT-DADGVEKRSA-N |
| XLogP | 4.11 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|