C20H19N5O2 — CID 109171770
N-(4-acetamidophenyl)-2-(pyridin-2-ylmethylamino)pyridine-4-carboxamide (PubChem CID 109171770) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-(pyridin-2-ylmethylamino)pyridine-4-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-2-(pyridin-2-ylmethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109171770 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(4-acetamidophenyl)-2-(pyridin-2-ylmethylamino)pyridine-4-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2ccnc(NCc3ccccn3)c2)cc1 |
| InChI | InChI=1S/C20H19N5O2/c1-14(26)24-16-5-7-17(8-6-16)25-20(27)15-9-11-22-19(12-15)23-13-18-4-2-3-10-21-18/h2-12H,13H2,1H3,(H,22,23)(H,24,26)(H,25,27) |
| InChIKey | SKEWUHFOKZMEOF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |