C23H23N3O5S — CID 10917417
(2R)-2-[1,1-dioxo-7-(4-phenylphenoxy)-4,5-dihydro-3H-1λ6,2,5-benzothiadiazepin-2-yl]-N-hydroxypropanamide (PubChem CID 10917417) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is (2R)-2-[1,1-dioxo-7-(4-phenylphenoxy)-4,5-dihydro-3H-1λ6,2,5-benzothiadiazepin-2-yl]-N-hydroxypropanamide.
| Compound Name | (2R)-2-[1,1-dioxo-7-(4-phenylphenoxy)-4,5-dihydro-3H-1λ6,2,5-benzothiadiazepin-2-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 10917417 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (2R)-2-[1,1-dioxo-7-(4-phenylphenoxy)-4,5-dihydro-3H-1λ6,2,5-benzothiadiazepin-2-yl]-N-hydroxypropanamide |
| SMILES | C[C@H](C(=O)NO)N1CCNc2cc(Oc3ccc(-c4ccccc4)cc3)ccc2S1(=O)=O |
| InChI | InChI=1S/C23H23N3O5S/c1-16(23(27)25-28)26-14-13-24-21-15-20(11-12-22(21)32(26,29)30)31-19-9-7-18(8-10-19)17-5-3-2-4-6-17/h2-12,15-16,24,28H,13-14H2,1H3,(H,25,27)/t16-/m1/s1 |
| InChIKey | ZZFYPMWQKLOJIR-MRXNPFEDSA-N |
| XLogP | 3.46 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|