C20H23N3O3 — CID 109175070
2-(1,3-benzodioxol-5-ylamino)-N-cycloheptylpyridine-4-carboxamide (PubChem CID 109175070) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-cycloheptylpyridine-4-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-cycloheptylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 109175070 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-cycloheptylpyridine-4-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1ccnc(Nc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C20H23N3O3/c24-20(23-15-5-3-1-2-4-6-15)14-9-10-21-19(11-14)22-16-7-8-17-18(12-16)26-13-25-17/h7-12,15H,1-6,13H2,(H,21,22)(H,23,24) |
| InChIKey | FHMZIAWVTBSNJH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |