C19H15FN8O4S — CID 10917667
4-[[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride (PubChem CID 10917667) has the molecular formula C19H15FN8O4S and a molecular weight of 470.45 g/mol. Its IUPAC name is 4-[[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride.
| Compound Name | 4-[[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 10917667 |
| Molecular Formula | C19H15FN8O4S |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 4-[[11-ethyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonyl fluoride |
| SMILES | CCn1cc2c(nc(NC(=O)Nc3ccc(S(=O)(=O)F)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C19H15FN8O4S/c1-2-27-10-13-15(25-27)23-18(28-17(13)22-16(26-28)14-4-3-9-32-14)24-19(29)21-11-5-7-12(8-6-11)33(20,30)31/h3-10H,2H2,1H3,(H2,21,23,24,25,29) |
| InChIKey | KMFFNBZQRKLUFF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |