C30H46S2 — CID 10917683
1,3,5-tri(propan-2-yl)-2-[[2,4,6-tri(propan-2-yl)phenyl]disulfanyl]benzene (PubChem CID 10917683) has the molecular formula C30H46S2 and a molecular weight of 470.83 g/mol. Its IUPAC name is 1,3,5-tri(propan-2-yl)-2-[[2,4,6-tri(propan-2-yl)phenyl]disulfanyl]benzene.
| Compound Name | 1,3,5-tri(propan-2-yl)-2-[[2,4,6-tri(propan-2-yl)phenyl]disulfanyl]benzene |
|---|---|
| PubChem CID | 10917683 |
| Molecular Formula | C30H46S2 |
| Molecular Weight | 470.83 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 1,3,5-tri(propan-2-yl)-2-[[2,4,6-tri(propan-2-yl)phenyl]disulfanyl]benzene |
| SMILES | CC(C)c1cc(C(C)C)c(SSc2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C30H46S2/c1-17(2)23-13-25(19(5)6)29(26(14-23)20(7)8)31-32-30-27(21(9)10)15-24(18(3)4)16-28(30)22(11)12/h13-22H,1-12H3 |
| InChIKey | ZLOCUDMSUFOLGX-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.83 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|