C15H12I2N2 — CID 10917731
4,12-diiodo-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 10917731) has the molecular formula C15H12I2N2 and a molecular weight of 474.08 g/mol. Its IUPAC name is 4,12-diiodo-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | 4,12-diiodo-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 10917731 |
| Molecular Formula | C15H12I2N2 |
| Molecular Weight | 474.08 g/mol |
| Exact Mass | 473.91 |
| IUPAC Name | 4,12-diiodo-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | Ic1ccc2c(c1)N1Cc3ccc(I)cc3N(C2)C1 |
| InChI | InChI=1S/C15H12I2N2/c16-12-3-1-10-7-18-9-19(14(10)5-12)8-11-2-4-13(17)6-15(11)18/h1-6H,7-9H2 |
| InChIKey | OIGXIQWRZVQYIZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.08 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|