C19H15Cl2N3O2 — CID 109177985
2-(2,3-dichloroanilino)-N-(3-methoxyphenyl)pyridine-4-carboxamide (PubChem CID 109177985) has the molecular formula C19H15Cl2N3O2 and a molecular weight of 388.25 g/mol. Its IUPAC name is 2-(2,3-dichloroanilino)-N-(3-methoxyphenyl)pyridine-4-carboxamide.
| Compound Name | 2-(2,3-dichloroanilino)-N-(3-methoxyphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109177985 |
| Molecular Formula | C19H15Cl2N3O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 2-(2,3-dichloroanilino)-N-(3-methoxyphenyl)pyridine-4-carboxamide |
| SMILES | COc1cccc(NC(=O)c2ccnc(Nc3cccc(Cl)c3Cl)c2)c1 |
| InChI | InChI=1S/C19H15Cl2N3O2/c1-26-14-5-2-4-13(11-14)23-19(25)12-8-9-22-17(10-12)24-16-7-3-6-15(20)18(16)21/h2-11H,1H3,(H,22,24)(H,23,25) |
| InChIKey | ZONOBIGDDPHWQV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |