C20H16F3N3O2 — CID 109178240
N-(2-methoxy-5-methylphenyl)-2-(2,3,4-trifluoroanilino)pyridine-4-carboxamide (PubChem CID 109178240) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-2-(2,3,4-trifluoroanilino)pyridine-4-carboxamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-2-(2,3,4-trifluoroanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109178240 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-2-(2,3,4-trifluoroanilino)pyridine-4-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)c1ccnc(Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C20H16F3N3O2/c1-11-3-6-16(28-2)15(9-11)26-20(27)12-7-8-24-17(10-12)25-14-5-4-13(21)18(22)19(14)23/h3-10H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | LPHPKICKPMJHGH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|