C25H48O5Si2 — CID 10917879
6-[(2R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylhept-6-en-2-yl]-2-hydroxy-2H-pyran-5-one (PubChem CID 10917879) has the molecular formula C25H48O5Si2 and a molecular weight of 484.83 g/mol. Its IUPAC name is 6-[(2R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylhept-6-en-2-yl]-2-hydroxy-2H-pyran-5-one.
| Compound Name | 6-[(2R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylhept-6-en-2-yl]-2-hydroxy-2H-pyran-5-one |
|---|---|
| PubChem CID | 10917879 |
| Molecular Formula | C25H48O5Si2 |
| Molecular Weight | 484.83 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 6-[(2R,5S)-1,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylhept-6-en-2-yl]-2-hydroxy-2H-pyran-5-one |
| SMILES | C=C(C)[C@H](CC[C@H](CO[Si](C)(C)C(C)(C)C)C1OC(O)C=CC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H48O5Si2/c1-18(2)21(30-32(11,12)25(6,7)8)15-13-19(17-28-31(9,10)24(3,4)5)23-20(26)14-16-22(27)29-23/h14,16,19,21-23,27H,1,13,15,17H2,2-12H3/t19-,21+,22?,23?/m1/s1 |
| InChIKey | UPXYHQWUTOYPIF-FEZPLFSRSA-N |
| XLogP | 6.21 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.83 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|