C19H12Cl2N4O — CID 109178950
2-(2-cyanoanilino)-N-(3,5-dichlorophenyl)pyridine-4-carboxamide (PubChem CID 109178950) has the molecular formula C19H12Cl2N4O and a molecular weight of 383.24 g/mol. Its IUPAC name is 2-(2-cyanoanilino)-N-(3,5-dichlorophenyl)pyridine-4-carboxamide.
| Compound Name | 2-(2-cyanoanilino)-N-(3,5-dichlorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109178950 |
| Molecular Formula | C19H12Cl2N4O |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-(2-cyanoanilino)-N-(3,5-dichlorophenyl)pyridine-4-carboxamide |
| SMILES | N#Cc1ccccc1Nc1cc(C(=O)Nc2cc(Cl)cc(Cl)c2)ccn1 |
| InChI | InChI=1S/C19H12Cl2N4O/c20-14-8-15(21)10-16(9-14)24-19(26)12-5-6-23-18(7-12)25-17-4-2-1-3-13(17)11-22/h1-10H,(H,23,25)(H,24,26) |
| InChIKey | HGSRURACDIOWFY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |