About [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate
[cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate (PubChem CID 10917916) has the molecular formula C26H32O4Se
and a molecular weight of 487.50 g/mol. Its IUPAC name is [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate |
| PubChem CID | 10917916 |
| Molecular Formula | C26H32O4Se |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate |
| SMILES | O=C(O[Se](OC(=O)C1CCCCC1)(c1ccccc1)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C26H32O4Se/c27-25(21-13-5-1-6-14-21)29-31(23-17-9-3-10-18-23,24-19-11-4-12-20-24)30-26(28)22-15-7-2-8-16-22/h3-4,9-12,17-22H,1-2,5-8,13-16H2 |
| InChIKey | WSKKKYHUSUGSAH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate?
The IUPAC name of [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate (CID 10917916) is [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate.
What is the SMILES notation for [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate?
The canonical SMILES for [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate is O=C(O[Se](OC(=O)C1CCCCC1)(c1ccccc1)c1ccccc1)C1CCCCC1.
What is the InChIKey of [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate?
The InChIKey is WSKKKYHUSUGSAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32O4Se/c27-25(21-13-5-1-6-14-21)29-31(23-17-9-3-10-18-23,24-19-11-4-12-20-24)30-26(28)22-15-7-2-8-16-22/h3-4,9-12,17-22H,1-2,5-8,13-16H2.
What are the key properties of [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate?
[cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate has a molecular weight of 487.50 g/mol, XLogP of 4.49, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclohexanecarbonyloxy(diphenyl)-λ4-selanyl] cyclohexanecarboxylate is sourced from PubChem (CID 10917916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).