C25H38O6S — CID 10917938
[2-[2-[(1S,2S,4aR)-1,2,5,5-tetramethyl-7-oxo-3,4,4a,6-tetrahydro-2H-naphthalen-1-yl]ethyl]-5-(furan-3-yl)pentyl] hydrogen sulfate (PubChem CID 10917938) has the molecular formula C25H38O6S and a molecular weight of 466.64 g/mol. Its IUPAC name is [2-[2-[(1S,2S,4aR)-1,2,5,5-tetramethyl-7-oxo-3,4,4a,6-tetrahydro-2H-naphthalen-1-yl]ethyl]-5-(furan-3-yl)pentyl] hydrogen sulfate.
| Compound Name | [2-[2-[(1S,2S,4aR)-1,2,5,5-tetramethyl-7-oxo-3,4,4a,6-tetrahydro-2H-naphthalen-1-yl]ethyl]-5-(furan-3-yl)pentyl] hydrogen sulfate |
|---|---|
| PubChem CID | 10917938 |
| Molecular Formula | C25H38O6S |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [2-[2-[(1S,2S,4aR)-1,2,5,5-tetramethyl-7-oxo-3,4,4a,6-tetrahydro-2H-naphthalen-1-yl]ethyl]-5-(furan-3-yl)pentyl] hydrogen sulfate |
| SMILES | C[C@H]1CC[C@H]2C(=CC(=O)CC2(C)C)[C@@]1(C)CCC(CCCc1ccoc1)COS(=O)(=O)O |
| InChI | InChI=1S/C25H38O6S/c1-18-8-9-22-23(14-21(26)15-24(22,2)3)25(18,4)12-10-19(17-31-32(27,28)29)6-5-7-20-11-13-30-16-20/h11,13-14,16,18-19,22H,5-10,12,15,17H2,1-4H3,(H,27,28,29)/t18-,19?,22-,25-/m0/s1 |
| InChIKey | HXZXVJCOLAWFQO-AFNDSEIKSA-N |
| XLogP | 5.80 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|