C18H21N3O3 — CID 109180300
5-[2-(4-methoxyphenoxy)ethylamino]-N-prop-2-enylpyridine-2-carboxamide (PubChem CID 109180300) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 5-[2-(4-methoxyphenoxy)ethylamino]-N-prop-2-enylpyridine-2-carboxamide.
| Compound Name | 5-[2-(4-methoxyphenoxy)ethylamino]-N-prop-2-enylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109180300 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 5-[2-(4-methoxyphenoxy)ethylamino]-N-prop-2-enylpyridine-2-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(NCCOc2ccc(OC)cc2)cn1 |
| InChI | InChI=1S/C18H21N3O3/c1-3-10-20-18(22)17-9-4-14(13-21-17)19-11-12-24-16-7-5-15(23-2)6-8-16/h3-9,13,19H,1,10-12H2,2H3,(H,20,22) |
| InChIKey | KEZJLNMGIGGRJO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|