C29H38O3SSi — CID 10918039
(2Z,7Z)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-12-[(2-methylpropan-2-yl)oxy]-3-phenylsulfanyldodeca-2,7-dien-5,9,11-triyn-1-ol (PubChem CID 10918039) has the molecular formula C29H38O3SSi and a molecular weight of 494.77 g/mol. Its IUPAC name is (2Z,7Z)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-12-[(2-methylpropan-2-yl)oxy]-3-phenylsulfanyldodeca-2,7-dien-5,9,11-triyn-1-ol.
| Compound Name | (2Z,7Z)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-12-[(2-methylpropan-2-yl)oxy]-3-phenylsulfanyldodeca-2,7-dien-5,9,11-triyn-1-ol |
|---|---|
| PubChem CID | 10918039 |
| Molecular Formula | C29H38O3SSi |
| Molecular Weight | 494.77 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | (2Z,7Z)-4-[tert-butyl(dimethyl)silyl]oxy-4-methyl-12-[(2-methylpropan-2-yl)oxy]-3-phenylsulfanyldodeca-2,7-dien-5,9,11-triyn-1-ol |
| SMILES | CC(C)(C)OC#CC#C/C=C\C#CC(C)(O[Si](C)(C)C(C)(C)C)/C(=C/CO)Sc1ccccc1 |
| InChI | InChI=1S/C29H38O3SSi/c1-27(2,3)31-24-18-13-11-10-12-17-22-29(7,32-34(8,9)28(4,5)6)26(21-23-30)33-25-19-15-14-16-20-25/h10,12,14-16,19-21,30H,23H2,1-9H3/b12-10-,26-21- |
| InChIKey | BSAPBEGCIYOMGZ-ILJWZRSDSA-N |
| XLogP | 6.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.77 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|