C18H23N3O — CID 109180718
N-butyl-5-(3,5-dimethylanilino)pyridine-2-carboxamide (PubChem CID 109180718) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-butyl-5-(3,5-dimethylanilino)pyridine-2-carboxamide.
| Compound Name | N-butyl-5-(3,5-dimethylanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109180718 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-butyl-5-(3,5-dimethylanilino)pyridine-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccc(Nc2cc(C)cc(C)c2)cn1 |
| InChI | InChI=1S/C18H23N3O/c1-4-5-8-19-18(22)17-7-6-15(12-20-17)21-16-10-13(2)9-14(3)11-16/h6-7,9-12,21H,4-5,8H2,1-3H3,(H,19,22) |
| InChIKey | MQVWANFAJPEOHF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|