C18H24N4O3S — CID 109180864
5-(butylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-2-carboxamide (PubChem CID 109180864) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 5-(butylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-(butylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109180864 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 5-(butylamino)-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-2-carboxamide |
| SMILES | CCCCNc1ccc(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)nc1 |
| InChI | InChI=1S/C18H24N4O3S/c1-2-3-11-20-15-6-9-17(22-13-15)18(23)21-12-10-14-4-7-16(8-5-14)26(19,24)25/h4-9,13,20H,2-3,10-12H2,1H3,(H,21,23)(H2,19,24,25) |
| InChIKey | IYADVACYIXQZKN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|