C16H18ClN3O — CID 109180928
5-(butylamino)-N-(4-chlorophenyl)pyridine-2-carboxamide (PubChem CID 109180928) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 5-(butylamino)-N-(4-chlorophenyl)pyridine-2-carboxamide.
| Compound Name | 5-(butylamino)-N-(4-chlorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109180928 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-(butylamino)-N-(4-chlorophenyl)pyridine-2-carboxamide |
| SMILES | CCCCNc1ccc(C(=O)Nc2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C16H18ClN3O/c1-2-3-10-18-14-8-9-15(19-11-14)16(21)20-13-6-4-12(17)5-7-13/h4-9,11,18H,2-3,10H2,1H3,(H,20,21) |
| InChIKey | XUQVNKNMJFVHEX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|