C18H22FN3O — CID 109181620
5-(butan-2-ylamino)-N-[2-(2-fluorophenyl)ethyl]pyridine-2-carboxamide (PubChem CID 109181620) has the molecular formula C18H22FN3O and a molecular weight of 315.39 g/mol. Its IUPAC name is 5-(butan-2-ylamino)-N-[2-(2-fluorophenyl)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-(butan-2-ylamino)-N-[2-(2-fluorophenyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109181620 |
| Molecular Formula | C18H22FN3O |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 5-(butan-2-ylamino)-N-[2-(2-fluorophenyl)ethyl]pyridine-2-carboxamide |
| SMILES | CCC(C)Nc1ccc(C(=O)NCCc2ccccc2F)nc1 |
| InChI | InChI=1S/C18H22FN3O/c1-3-13(2)22-15-8-9-17(21-12-15)18(23)20-11-10-14-6-4-5-7-16(14)19/h4-9,12-13,22H,3,10-11H2,1-2H3,(H,20,23) |
| InChIKey | BENWHJDVQOLHDH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |