C20H35N5O10 — CID 10918175
2-[4,7,10,13-tetrakis(carboxymethyl)-1,4,7,10,13-pentazacyclopentadec-1-yl]acetic acid (PubChem CID 10918175) has the molecular formula C20H35N5O10 and a molecular weight of 505.53 g/mol. Its IUPAC name is 2-[4,7,10,13-tetrakis(carboxymethyl)-1,4,7,10,13-pentazacyclopentadec-1-yl]acetic acid.
| Compound Name | 2-[4,7,10,13-tetrakis(carboxymethyl)-1,4,7,10,13-pentazacyclopentadec-1-yl]acetic acid |
|---|---|
| PubChem CID | 10918175 |
| Molecular Formula | C20H35N5O10 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 2-[4,7,10,13-tetrakis(carboxymethyl)-1,4,7,10,13-pentazacyclopentadec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C20H35N5O10/c26-16(27)11-21-1-2-22(12-17(28)29)5-6-24(14-19(32)33)9-10-25(15-20(34)35)8-7-23(4-3-21)13-18(30)31/h1-15H2,(H,26,27)(H,28,29)(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | HKFKNKJQPIZCIO-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 202.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |