C16H17Cl2N3O — CID 109181756
5-(butan-2-ylamino)-N-(3,4-dichlorophenyl)pyridine-2-carboxamide (PubChem CID 109181756) has the molecular formula C16H17Cl2N3O and a molecular weight of 338.24 g/mol. Its IUPAC name is 5-(butan-2-ylamino)-N-(3,4-dichlorophenyl)pyridine-2-carboxamide.
| Compound Name | 5-(butan-2-ylamino)-N-(3,4-dichlorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109181756 |
| Molecular Formula | C16H17Cl2N3O |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 5-(butan-2-ylamino)-N-(3,4-dichlorophenyl)pyridine-2-carboxamide |
| SMILES | CCC(C)Nc1ccc(C(=O)Nc2ccc(Cl)c(Cl)c2)nc1 |
| InChI | InChI=1S/C16H17Cl2N3O/c1-3-10(2)20-12-5-7-15(19-9-12)16(22)21-11-4-6-13(17)14(18)8-11/h4-10,20H,3H2,1-2H3,(H,21,22) |
| InChIKey | COFKIXXKPAUWFX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |