C17H25N3O2 — CID 109183069
5-(cyclohexylamino)-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide (PubChem CID 109183069) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 5-(cyclohexylamino)-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 5-(cyclohexylamino)-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109183069 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 5-(cyclohexylamino)-N-(oxolan-2-ylmethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1ccc(NC2CCCCC2)cn1 |
| InChI | InChI=1S/C17H25N3O2/c21-17(19-12-15-7-4-10-22-15)16-9-8-14(11-18-16)20-13-5-2-1-3-6-13/h8-9,11,13,15,20H,1-7,10,12H2,(H,19,21) |
| InChIKey | IVXNEJUYEOTGSB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |