C22H33Cl3O7 — CID 10918316
tert-butyl (6R,7S,8S)-4,4,6,8-tetramethyl-3,5-dioxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate (PubChem CID 10918316) has the molecular formula C22H33Cl3O7 and a molecular weight of 515.86 g/mol. Its IUPAC name is tert-butyl (6R,7S,8S)-4,4,6,8-tetramethyl-3,5-dioxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate.
| Compound Name | tert-butyl (6R,7S,8S)-4,4,6,8-tetramethyl-3,5-dioxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate |
|---|---|
| PubChem CID | 10918316 |
| Molecular Formula | C22H33Cl3O7 |
| Molecular Weight | 515.86 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | tert-butyl (6R,7S,8S)-4,4,6,8-tetramethyl-3,5-dioxo-7-(2,2,2-trichloroethoxycarbonyloxy)undec-10-enoate |
| SMILES | C=CC[C@H](C)[C@H](OC(=O)OCC(Cl)(Cl)Cl)[C@@H](C)C(=O)C(C)(C)C(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33Cl3O7/c1-9-10-13(2)17(31-19(29)30-12-22(23,24)25)14(3)18(28)21(7,8)15(26)11-16(27)32-20(4,5)6/h9,13-14,17H,1,10-12H2,2-8H3/t13-,14+,17-/m0/s1 |
| InChIKey | GJIVUBOLJPTECL-VBQJREDUSA-N |
| XLogP | 5.62 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.86 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|