C32H53NO5 — CID 10918483
[(1S,3R,7S,8S,8aR)-8-[2-[(4R,6R)-6-[2-(butylamino)-2-oxoethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 10918483) has the molecular formula C32H53NO5 and a molecular weight of 531.78 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-8-[2-[(4R,6R)-6-[2-(butylamino)-2-oxoethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-8-[2-[(4R,6R)-6-[2-(butylamino)-2-oxoethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 10918483 |
| Molecular Formula | C32H53NO5 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.39 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-8-[2-[(4R,6R)-6-[2-(butylamino)-2-oxoethyl]-2,2-dimethyl-1,3-dioxan-4-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCCCNC(=O)C[C@H]1C[C@@H](CC[C@@H]2[C@@H]3C(=C[C@H](C)C[C@@H]3OC(=O)C(C)(C)CC)C=C[C@@H]2C)OC(C)(C)O1 |
| InChI | InChI=1S/C32H53NO5/c1-9-11-16-33-28(34)20-25-19-24(37-32(7,8)38-25)14-15-26-22(4)12-13-23-17-21(3)18-27(29(23)26)36-30(35)31(5,6)10-2/h12-13,17,21-22,24-27,29H,9-11,14-16,18-20H2,1-8H3,(H,33,34)/t21-,22-,24+,25+,26-,27-,29-/m0/s1 |
| InChIKey | JHBSBGAJWWCMLL-XGLSIGFFSA-N |
| XLogP | 6.74 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|