C30H32N2O5S — CID 10918491
5-[[6-[2-[(3aS,4S,6aR)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethoxy]naphthalen-2-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10918491) has the molecular formula C30H32N2O5S and a molecular weight of 532.66 g/mol. Its IUPAC name is 5-[[6-[2-[(3aS,4S,6aR)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethoxy]naphthalen-2-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[6-[2-[(3aS,4S,6aR)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethoxy]naphthalen-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10918491 |
| Molecular Formula | C30H32N2O5S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 5-[[6-[2-[(3aS,4S,6aR)-5-benzyl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethoxy]naphthalen-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1(C)O[C@@H]2[C@@H](CN(Cc3ccccc3)[C@H]2CCOc2ccc3cc(CC4SC(=O)NC4=O)ccc3c2)O1 |
| InChI | InChI=1S/C30H32N2O5S/c1-30(2)36-25-18-32(17-19-6-4-3-5-7-19)24(27(25)37-30)12-13-35-23-11-10-21-14-20(8-9-22(21)16-23)15-26-28(33)31-29(34)38-26/h3-11,14,16,24-27H,12-13,15,17-18H2,1-2H3,(H,31,33,34)/t24-,25+,26?,27-/m0/s1 |
| InChIKey | HNBJEEUEBBKUAF-UEEAVMEZSA-N |
| XLogP | 4.91 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|