C22H27N3O13 — CID 10918586
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,2S,3R,5R)-2-carbonazidoyl-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 10918586) has the molecular formula C22H27N3O13 and a molecular weight of 541.47 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,2S,3R,5R)-2-carbonazidoyl-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,2S,3R,5R)-2-carbonazidoyl-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10918586 |
| Molecular Formula | C22H27N3O13 |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(1S,2S,3R,5R)-2-carbonazidoyl-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H]2C[C@H]3C[C@H](C(=O)O3)[C@@H]2C(=O)N=[N+]=[N-])[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H27N3O13/c1-8(26)32-7-15-17(33-9(2)27)18(34-10(3)28)19(35-11(4)29)22(38-15)37-14-6-12-5-13(21(31)36-12)16(14)20(30)24-25-23/h12-19,22H,5-7H2,1-4H3/t12-,13+,14-,15-,16+,17-,18+,19-,22-/m1/s1 |
| InChIKey | VAEMJKWUUDYTAX-DYJFJFQCSA-N |
| XLogP | 0.24 |
| TPSA | 215.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|