C37H39NO3 — CID 10918621
(5S)-1-[(3S)-3-phenylheptanoyl]-5-(trityloxymethyl)pyrrolidin-2-one (PubChem CID 10918621) has the molecular formula C37H39NO3 and a molecular weight of 545.72 g/mol. Its IUPAC name is (5S)-1-[(3S)-3-phenylheptanoyl]-5-(trityloxymethyl)pyrrolidin-2-one.
| Compound Name | (5S)-1-[(3S)-3-phenylheptanoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 10918621 |
| Molecular Formula | C37H39NO3 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | (5S)-1-[(3S)-3-phenylheptanoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
| SMILES | CCCC[C@@H](CC(=O)N1C(=O)CC[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H39NO3/c1-2-3-16-30(29-17-8-4-9-18-29)27-36(40)38-34(25-26-35(38)39)28-41-37(31-19-10-5-11-20-31,32-21-12-6-13-22-32)33-23-14-7-15-24-33/h4-15,17-24,30,34H,2-3,16,25-28H2,1H3/t30-,34-/m0/s1 |
| InChIKey | WWYHPRCYIDLEGQ-NHZFLZHXSA-N |
| XLogP | 7.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|