C35H35NO5 — CID 10918651
(2R,3R,4S,5R,6R)-2-isocyano-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 10918651) has the molecular formula C35H35NO5 and a molecular weight of 549.67 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-isocyano-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4S,5R,6R)-2-isocyano-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 10918651 |
| Molecular Formula | C35H35NO5 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-isocyano-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | [C-]#[N+][C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H35NO5/c1-36-35-34(40-25-30-20-12-5-13-21-30)33(39-24-29-18-10-4-11-19-29)32(38-23-28-16-8-3-9-17-28)31(41-35)26-37-22-27-14-6-2-7-15-27/h2-21,31-35H,22-26H2/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | JGNABDHPVLQKFE-CKQPALCZSA-N |
| XLogP | 6.60 |
| TPSA | 50.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|