C18H19F3N4O — CID 109186751
(4-ethylpiperazin-1-yl)-[5-(2,3,4-trifluoroanilino)-2-pyridinyl]methanone (PubChem CID 109186751) has the molecular formula C18H19F3N4O and a molecular weight of 364.37 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[5-(2,3,4-trifluoroanilino)-2-pyridinyl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[5-(2,3,4-trifluoroanilino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 109186751 |
| Molecular Formula | C18H19F3N4O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[5-(2,3,4-trifluoroanilino)-2-pyridinyl]methanone |
| SMILES | CCN1CCN(C(=O)c2ccc(Nc3ccc(F)c(F)c3F)cn2)CC1 |
| InChI | InChI=1S/C18H19F3N4O/c1-2-24-7-9-25(10-8-24)18(26)15-5-3-12(11-22-15)23-14-6-4-13(19)16(20)17(14)21/h3-6,11,23H,2,7-10H2,1H3 |
| InChIKey | HPNISXGVBGLXIM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|