C18H20N4O2 — CID 109186970
4-[5-(3-methylanilino)pyridine-2-carbonyl]piperazine-1-carbaldehyde (PubChem CID 109186970) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[5-(3-methylanilino)pyridine-2-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[5-(3-methylanilino)pyridine-2-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 109186970 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-[5-(3-methylanilino)pyridine-2-carbonyl]piperazine-1-carbaldehyde |
| SMILES | Cc1cccc(Nc2ccc(C(=O)N3CCN(C=O)CC3)nc2)c1 |
| InChI | InChI=1S/C18H20N4O2/c1-14-3-2-4-15(11-14)20-16-5-6-17(19-12-16)18(24)22-9-7-21(13-23)8-10-22/h2-6,11-13,20H,7-10H2,1H3 |
| InChIKey | NJFOOFOUHQHMEG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|