C27H30N2O7S2 — CID 10918730
(4aR,8aR)-2-(benzenesulfonyl)-8a-[[(4R)-3-(benzenesulfonyl)-2,2-dimethyl-1,3-oxazolidin-4-yl]methyl]-3,4,4a,5-tetrahydroisoquinoline-1,6-dione (PubChem CID 10918730) has the molecular formula C27H30N2O7S2 and a molecular weight of 558.68 g/mol. Its IUPAC name is (4aR,8aR)-2-(benzenesulfonyl)-8a-[[(4R)-3-(benzenesulfonyl)-2,2-dimethyl-1,3-oxazolidin-4-yl]methyl]-3,4,4a,5-tetrahydroisoquinoline-1,6-dione.
| Compound Name | (4aR,8aR)-2-(benzenesulfonyl)-8a-[[(4R)-3-(benzenesulfonyl)-2,2-dimethyl-1,3-oxazolidin-4-yl]methyl]-3,4,4a,5-tetrahydroisoquinoline-1,6-dione |
|---|---|
| PubChem CID | 10918730 |
| Molecular Formula | C27H30N2O7S2 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | (4aR,8aR)-2-(benzenesulfonyl)-8a-[[(4R)-3-(benzenesulfonyl)-2,2-dimethyl-1,3-oxazolidin-4-yl]methyl]-3,4,4a,5-tetrahydroisoquinoline-1,6-dione |
| SMILES | CC1(C)OC[C@@H](C[C@]23C=CC(=O)C[C@H]2CCN(S(=O)(=O)c2ccccc2)C3=O)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O7S2/c1-26(2)29(38(34,35)24-11-7-4-8-12-24)21(19-36-26)18-27-15-13-22(30)17-20(27)14-16-28(25(27)31)37(32,33)23-9-5-3-6-10-23/h3-13,15,20-21H,14,16-19H2,1-2H3/t20-,21-,27-/m1/s1 |
| InChIKey | QCSUQUFAPWEGIP-LGVUCKNBSA-N |
| XLogP | 2.96 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |