C22H23N3O — CID 109188308
N-(4-ethylphenyl)-5-[(2-methylphenyl)methylamino]pyridine-2-carboxamide (PubChem CID 109188308) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is N-(4-ethylphenyl)-5-[(2-methylphenyl)methylamino]pyridine-2-carboxamide.
| Compound Name | N-(4-ethylphenyl)-5-[(2-methylphenyl)methylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109188308 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-(4-ethylphenyl)-5-[(2-methylphenyl)methylamino]pyridine-2-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2ccc(NCc3ccccc3C)cn2)cc1 |
| InChI | InChI=1S/C22H23N3O/c1-3-17-8-10-19(11-9-17)25-22(26)21-13-12-20(15-24-21)23-14-18-7-5-4-6-16(18)2/h4-13,15,23H,3,14H2,1-2H3,(H,25,26) |
| InChIKey | DULPZEWLIDRIGE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |