C34H40N2O6 — CID 10918853
ditert-butyl 1'-benzyl-5-cyclohexylimino-2'-oxospiro[furan-2,3'-indole]-3,4-dicarboxylate (PubChem CID 10918853) has the molecular formula C34H40N2O6 and a molecular weight of 572.70 g/mol. Its IUPAC name is ditert-butyl 1'-benzyl-5-cyclohexylimino-2'-oxospiro[furan-2,3'-indole]-3,4-dicarboxylate.
| Compound Name | ditert-butyl 1'-benzyl-5-cyclohexylimino-2'-oxospiro[furan-2,3'-indole]-3,4-dicarboxylate |
|---|---|
| PubChem CID | 10918853 |
| Molecular Formula | C34H40N2O6 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | ditert-butyl 1'-benzyl-5-cyclohexylimino-2'-oxospiro[furan-2,3'-indole]-3,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=O)OC(C)(C)C)C2(O/C1=N\C1CCCCC1)C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C34H40N2O6/c1-32(2,3)41-29(37)26-27(30(38)42-33(4,5)6)34(40-28(26)35-23-17-11-8-12-18-23)24-19-13-14-20-25(24)36(31(34)39)21-22-15-9-7-10-16-22/h7,9-10,13-16,19-20,23H,8,11-12,17-18,21H2,1-6H3/b35-28- |
| InChIKey | XJWMUURAFLJGCP-NUDFZHEQSA-N |
| XLogP | 6.17 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|