C23H25N3O — CID 109189121
N-benzyl-N-methyl-5-(3-phenylpropylamino)pyridine-2-carboxamide (PubChem CID 109189121) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is N-benzyl-N-methyl-5-(3-phenylpropylamino)pyridine-2-carboxamide.
| Compound Name | N-benzyl-N-methyl-5-(3-phenylpropylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109189121 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-benzyl-N-methyl-5-(3-phenylpropylamino)pyridine-2-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccc(NCCCc2ccccc2)cn1 |
| InChI | InChI=1S/C23H25N3O/c1-26(18-20-11-6-3-7-12-20)23(27)22-15-14-21(17-25-22)24-16-8-13-19-9-4-2-5-10-19/h2-7,9-12,14-15,17,24H,8,13,16,18H2,1H3 |
| InChIKey | FOYPILOWYRTMND-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|