C26H29N3O — CID 109189255
[5-[benzyl(methyl)amino]-2-pyridinyl]-(4-benzylpiperidin-1-yl)methanone (PubChem CID 109189255) has the molecular formula C26H29N3O and a molecular weight of 399.54 g/mol. Its IUPAC name is [5-[benzyl(methyl)amino]-2-pyridinyl]-(4-benzylpiperidin-1-yl)methanone.
| Compound Name | [5-[benzyl(methyl)amino]-2-pyridinyl]-(4-benzylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109189255 |
| Molecular Formula | C26H29N3O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | [5-[benzyl(methyl)amino]-2-pyridinyl]-(4-benzylpiperidin-1-yl)methanone |
| SMILES | CN(Cc1ccccc1)c1ccc(C(=O)N2CCC(Cc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C26H29N3O/c1-28(20-23-10-6-3-7-11-23)24-12-13-25(27-19-24)26(30)29-16-14-22(15-17-29)18-21-8-4-2-5-9-21/h2-13,19,22H,14-18,20H2,1H3 |
| InChIKey | OOTZKVFHYQCPJD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |