C20H17F2N3O — CID 109189342
N-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methylamino]pyridine-2-carboxamide (PubChem CID 109189342) has the molecular formula C20H17F2N3O and a molecular weight of 353.37 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methylamino]pyridine-2-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109189342 |
| Molecular Formula | C20H17F2N3O |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-5-[(4-fluorophenyl)methylamino]pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1F)c1ccc(NCc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C20H17F2N3O/c21-16-7-5-14(6-8-16)11-23-17-9-10-19(24-13-17)20(26)25-12-15-3-1-2-4-18(15)22/h1-10,13,23H,11-12H2,(H,25,26) |
| InChIKey | QCGFAAJAAJUMLO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |