C20H17ClFN3O2 — CID 109189780
N-(3-chloro-4-methoxyphenyl)-5-[(4-fluorophenyl)methylamino]pyridine-2-carboxamide (PubChem CID 109189780) has the molecular formula C20H17ClFN3O2 and a molecular weight of 385.83 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-5-[(4-fluorophenyl)methylamino]pyridine-2-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-5-[(4-fluorophenyl)methylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109189780 |
| Molecular Formula | C20H17ClFN3O2 |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-5-[(4-fluorophenyl)methylamino]pyridine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NCc3ccc(F)cc3)cn2)cc1Cl |
| InChI | InChI=1S/C20H17ClFN3O2/c1-27-19-9-7-15(10-17(19)21)25-20(26)18-8-6-16(12-24-18)23-11-13-2-4-14(22)5-3-13/h2-10,12,23H,11H2,1H3,(H,25,26) |
| InChIKey | WOJOQPZIEGDKFW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |