C22H22N4O3 — CID 109190534
N-(4-acetamidophenyl)-5-[(4-methoxyphenyl)methylamino]pyridine-2-carboxamide (PubChem CID 109190534) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-5-[(4-methoxyphenyl)methylamino]pyridine-2-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-5-[(4-methoxyphenyl)methylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109190534 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-(4-acetamidophenyl)-5-[(4-methoxyphenyl)methylamino]pyridine-2-carboxamide |
| SMILES | COc1ccc(CNc2ccc(C(=O)Nc3ccc(NC(C)=O)cc3)nc2)cc1 |
| InChI | InChI=1S/C22H22N4O3/c1-15(27)25-17-5-7-18(8-6-17)26-22(28)21-12-9-19(14-24-21)23-13-16-3-10-20(29-2)11-4-16/h3-12,14,23H,13H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | RELUUUJWKOLSSH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |